605-65-2
| Name | Dansyl chloride |
| CAS | 605-65-2 |
| EINECS(EC#) | 210-092-6 |
| Molecular Formula | C12H12ClNO2S |
| MDL Number | MFCD00003985 |
| Molecular Weight | 269.75 |
| MOL File | 605-65-2.mol |
Chemical Properties
| Appearance | yellow to orange-yellow crystalline powder |
| Melting point | 72-74 °C(lit.) |
| Boiling point | 371.3±22.0 °C(Predicted) |
| density | 1.1702 (rough estimate) |
| refractive index | 1.5630 (estimate) |
| storage temp. | 2-8°C |
| solubility | acetone: 50 mg/mL |
| form | powder and chunks |
| pka | 2.38±0.40(Predicted) |
| color | yellow to orange |
| Water Solubility | Soluble in dimethyl fluoride, acetone, chloroform, pyridine, benzene and dioxane. Insoluble in water. |
| Sensitive | Moisture Sensitive |
| Detection Methods | HPLC,NMR |
| Merck | 14,2814 |
| BRN | 2217205 |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | 1S/C12H12ClNO2S/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16/h3-8H,1-2H3 |
| InChIKey | XPDXVDYUQZHFPV-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(cccc12)S(Cl)(=O)=O |
Safety Data
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P305+P351+P338+P310 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | QK3688000 |
| F | 10-21 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214980 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Met. Corr. 1 Skin Corr. 1B |
| Safety Profile |