1-BroMoheptadecafluorooctane
- Product Name1-BroMoheptadecafluorooctane
- CAS423-55-2
- CBNumberCB5409529
- MFC8BrF17
- MW498.96
- EINECS207-028-4
- MDL NumberMFCD00042082
- MOL File423-55-2.mol
Chemical Properties
| Melting point: | 6 °C (43 °F) |
| Boiling point: | 142 °C (288 °F) |
| Density | 1.93 g/cm3 |
| vapor pressure | 12.8-72hPa at 25-65℃ |
| refractive index | 1.30 |
| Flash point: | Not applicable |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.930 |
| Water Solubility | Not miscible or difficult to mix in water. |
| Merck | 14,7156 |
| BRN | 2016022 |
| Cosmetics Ingredients Functions | SOLVENT |
| InChI | 1S/C8BrF17/c9-7(22,23)5(18,19)3(14,15)1(10,11)2(12,13)4(16,17)6(20,21)8(24,25)26 |
| InChIKey | WTWWXOGTJWMJHI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| LogP | 6.1 at 25℃ |
| CAS DataBase Reference | 423-55-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Bromoheptadecafluorooctane (423-55-2) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| RIDADR | 2810 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | RG8700000 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2903780000 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Toxicity | LD50 i.v. in female rats: 41 g/kg (Burgan) | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|