4-Chloro-7-azaindole
- Product Name4-Chloro-7-azaindole
- CAS55052-28-3
- CBNumberCB5364013
- MFC7H5ClN2
- MW152.58
- EINECS626-806-8
- MDL NumberMFCD08272232
- MOL File55052-28-3.mol
Chemical Properties
| Melting point: | 176-181 °C |
| Density | 1.425±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 12.98±0.40(Predicted) |
| form | solid |
| color | Light yellow to brown |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H5ClN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
| InChIKey | HNTZVGMWXCFCTA-UHFFFAOYSA-N |
| SMILES | C12NC=CC1=C(Cl)C=CN=2 |
| CAS DataBase Reference | 55052-28-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 22-37/38-41 | |||||||||
| Safety Statements | 26-39 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| HazardClass | IRRITANT | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 2933990099 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
