1,1'-Thiocarbonyldi-2(1H)-pyridone
- Product Name1,1'-Thiocarbonyldi-2(1H)-pyridone
- CAS102368-13-8
- CBNumberCB5353301
- MFC11H8N2O2S
- MW232.26
- MDL NumberMFCD00075238
- MOL File102368-13-8.mol
Chemical Properties
| Melting point: | 163-166 °C(lit.) |
| Boiling point: | 385.2±25.0 °C(Predicted) |
| Density | 1.485 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | -1.70±0.23(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | InChI=1S/C11H8N2O2S/c14-9-5-1-3-7-12(9)11(16)13-8-4-2-6-10(13)15/h1-8H |
| InChIKey | KXMMNJQMGILZDB-UHFFFAOYSA-N |
| SMILES | C(N1C(=O)C=CC=C1)(N1C(=O)C=CC=C1)=S |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2933.79.8500 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|