3,4-Dimethoxybenzenesulfonyl chloride
- Product Name3,4-Dimethoxybenzenesulfonyl chloride
- CAS23095-31-0
- CBNumberCB5294114
- MFC8H9ClO4S
- MW236.67
- MDL NumberMFCD00051769
- MOL File23095-31-0.mol
Chemical Properties
| Melting point: | 67-70 °C (lit.) |
| Boiling point: | 346.2±27.0 °C(Predicted) |
| Density | 1.359±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | Crystalline Powder |
| color | Off-white to beige |
| Sensitive | Moisture Sensitive |
| BRN | 2840170 |
| InChI | 1S/C8H9ClO4S/c1-12-7-4-3-6(14(9,10)11)5-8(7)13-2/h3-5H,1-2H3 |
| InChIKey | RSJSYCZYQNJQPY-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1OC)S(Cl)(=O)=O |
| CAS DataBase Reference | 23095-31-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H318 | |||||||||
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2909309090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|