1-Butylpyridinium tetrafluoroborate
- Product Name1-Butylpyridinium tetrafluoroborate
- CAS203389-28-0
- CBNumberCB5281145
- MFC9H14BF4N
- MW223.02
- EINECS679-531-0
- MDL NumberMFCD03427602
- MOL File203389-28-0.mol
Chemical Properties
| Melting point: | 6.64 °C(Solv: acetonitrile (75-05-8)) |
| Density | 1.22 |
| refractive index | 1.45 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow |
| InChI | InChI=1S/C9H14N.BF4/c1-2-3-7-10-8-5-4-6-9-10;2-1(3,4)5/h4-6,8-9H,2-3,7H2,1H3;/q+1;-1 |
| InChIKey | XLWDQAHXRCBPEE-UHFFFAOYSA-N |
| SMILES | [N+]1(CCCC)=CC=CC=C1.[B-](F)(F)(F)F |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H314 | |||||||||
| Precautionary statements | P260-P264-P270-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38-34-40/20/22 | |||||||||
| Safety Statements | 37/39-26-36/37 | |||||||||
| RIDADR | 1760 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2933399090 | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|