2'-Chloro-5'-(trifluoromethyl)acetophenone
- Product Name2'-Chloro-5'-(trifluoromethyl)acetophenone
- CAS71648-45-8
- CBNumberCB5197318
- MFC9H6ClF3O
- MW222.59
- MDL NumberMFCD00045092
- MOL File71648-45-8.mol
Chemical Properties
| Boiling point: | 204-205 °C(lit.) |
| Density | 1.392 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 196 °F |
| storage temp. | Store at room temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Water Solubility | Sparingly soluble in water 0.11g/L @ 25°C. |
| InChI | 1S/C9H6ClF3O/c1-5(14)7-4-6(9(11,12)13)2-3-8(7)10/h2-4H,1H3 |
| InChIKey | YRGBMTWHOFQSDJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(ccc1Cl)C(F)(F)F |
| CAS DataBase Reference | 71648-45-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H227-H315-H319-H335 | |||||||||
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a | |||||||||
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) | |||||||||
| Hazard Codes | Xi,F | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | 1993 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Flammable/Irritant | |||||||||
| HazardClass | FLAMMABLE | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|