Benzyltrimethylammonium chloride
- Product NameBenzyltrimethylammonium chloride
- CAS56-93-9
- CBNumberCB5145041
- MFC10H16ClN
- MW185.69
- EINECS200-300-3
- MDL NumberMFCD00011782
- MOL File56-93-9.mol
Chemical Properties
| Melting point: | 239 °C (dec.) (lit.) |
| Boiling point: | 305.52°C (rough estimate) |
| Density | 1.08 g/mL at 25 °C |
| vapor pressure | <0.0001 hPa (20 °C) |
| refractive index | n |
| Flash point: | <50° (for 61%sol), d: 1.07 at 20°/20° (61% sol) |
| storage temp. | Store below +30°C. |
| solubility | 800g/l |
| form | Crystalline Powder or Chunks |
| color | White to ivory |
| PH | 6-8 (100g/l, H2O, 20℃) |
| Odor | Faint, almond like odor |
| PH Range | 6 - 8 |
| Water Solubility | 800 g/L |
| Sensitive | Hygroscopic |
| BRN | 3917255 |
| Henry's Law Constant | 2.9×108 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| InChI | 1S/C10H16N.ClH/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KXHPPCXNWTUNSB-UHFFFAOYSA-M |
| SMILES | [Cl-].C[N+](C)(C)Cc1ccccc1 |
| CAS DataBase Reference | 56-93-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzyltrimethylammonium chloride (56-93-9) |
Safety
| Symbol(GHS) |
  GHS06,GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311-H332-H341-H412 | |||||||||
| Precautionary statements | P201-P273-P280-P301+P310-P302+P352+P312-P304+P340+P312 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36/38-36 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | BO8400000 | |||||||||
| F | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2923900090 | |||||||||
| Storage Class |
6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Dermal Acute Tox. 3 Oral Acute Tox. 4 Inhalation Aquatic Chronic 3 Muta. 2 |
|||||||||
| Hazardous Substances Data | 56-93-9(Hazardous Substances Data) | |||||||||
| Toxicity | LD50 orally in Rabbit: 500 mg/kg | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|