2,3-Epoxypropyltrimethylammonium chloride
- Product Name2,3-Epoxypropyltrimethylammonium chloride
- CAS3033-77-0
- CBNumberCB1246988
- MFC6H14ClNO
- MW151.63
- EINECS221-221-0
- MDL NumberMFCD00011940
- MOL File3033-77-0.mol
Chemical Properties
| Melting point: | 10 °C |
| Density | 1.13 |
| refractive index | 1.48 |
| Flash point: | 170 °C - closed cup |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly), Water (Sparingly) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 852g/L at 20℃ |
| BRN | 3914931 |
| Stability: | Stable. Incompatible with oxidizing agents |
| InChI | InChI=1S/C6H14NO.ClH/c1-7(2,3)4-6-5-8-6;/h6H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | PUVAFTRIIUSGLK-UHFFFAOYSA-M |
| SMILES | [N+](C)(C)(C)CC1OC1.[Cl-] |
| CAS DataBase Reference | 3033-77-0(CAS DataBase Reference) |
| EPA Substance Registry System | Glycidyltrimethylammonium chloride (3033-77-0) |
Safety
| Symbol(GHS) |
   GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312-H317-H318-H341-H350-H360F-H373-H412 |
| Precautionary statements | P201-P273-P280-P302+P352+P312-P305+P351+P338+P310-P308+P313 |
| target organs | Kidney |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 45-21/22-41-43-48/22-68-52/53-20/21/22-60 |
| Safety Statements | 53-14-26-36/37/39-45-61 |
| WGK Germany | 3 |
| RTECS | BQ3480000 |
| TSCA | TSCA listed |
| HS Code | 2923900090 |
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications |
Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Carc. 1B Eye Dam. 1 Muta. 2 Repr. 1B Skin Sens. 1 STOT RE 2 STOT SE 2 |
| REACH Registrations | Active |