2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate
- Product Name2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate
- CAS10081-39-7
- CBNumberCB4779308
- MFC41H29NO
- MW551.69
- MDL NumberMFCD00013355
- MOL File10081-39-7.mol
Chemical Properties
| Melting point: | 271-275 °C(lit.) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Sonicated) |
| form | Solid |
| color | Dark Green to Very Dark Grey |
| λmax | 306 nm 551 nm (2nd) |
| BRN | 1444580 |
| Stability: | Stable. Incompatible with acids and strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C41H29NO/c43-41-37(31-18-8-2-9-19-31)28-36(29-38(41)32-20-10-3-11-21-32)42-39(33-22-12-4-13-23-33)26-35(30-16-6-1-7-17-30)27-40(42)34-24-14-5-15-25-34/h1-29H |
| InChIKey | UWOVWIIOKHRNKU-UHFFFAOYSA-N |
| SMILES | [O-]c1c(cc(cc1-c2ccccc2)-[n+]3c(cc(cc3-c4ccccc4)-c5ccccc5)-c6ccccc6)-c7ccccc7 |
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |