1,4-Bis(2-methylstyryl)benzene
- Product Name1,4-Bis(2-methylstyryl)benzene
- CAS13280-61-0
- CBNumberCB4770976
- MFC24H22
- MW310.43
- EINECS236-285-5
- MDL NumberMFCD00008529
- MOL File13280-61-0.mol
Chemical Properties
| Melting point: | 180-182 °C(lit.) |
| Boiling point: | 385.59°C (rough estimate) |
| Density | 1.0591 (estimate) |
| refractive index | 1.9130 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | dioxane: 0.5 g/10 mL at hot, clear to hazy, colorless to light yellow |
| form | Crystalline Powder |
| color | Light green to yellow-green |
| Sensitive | Light Sensitive |
| BRN | 2375845 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C24H22/c1-19-7-3-5-9-23(19)17-15-21-11-13-22(14-12-21)16-18-24-10-6-4-8-20(24)2/h3-18H,1-2H3 |
| InChIKey | QKLPIYTUUFFRLV-UHFFFAOYSA-N |
| SMILES | C1(C=CC2=CC=CC=C2C)=CC=C(C=CC2=CC=CC=C2C)C=C1 |
| CAS DataBase Reference | 13280-61-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1,4-bis[2-(2-methylphenyl)ethenyl]- (13280-61-0) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H319-H413 | |||||||||
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36 | |||||||||
| Safety Statements | 24/25-36-26 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-23 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2902909000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 |
|||||||||
| NFPA 704: |
|