7-Methoxycoumarin-4-acetic acid
- Product Name7-Methoxycoumarin-4-acetic acid
- CAS62935-72-2
- CBNumberCB4734907
- MFC12H10O5
- MW234.2
- MDL NumberMFCD00009774
- MOL File62935-72-2.mol
Chemical Properties
| Melting point: | 193 °C (dec.)(lit.) |
| Boiling point: | 472.9±45.0 °C(Predicted) |
| Density | 1.367±0.06 g/cm3(Predicted) |
| Flash point: | 87°(189°F) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Soluble in acetone and dimethyl sulfoxide. |
| pka | 4.22±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| ex/em | λex 323 nm; λem 382 nm in MeOH |
| Stability: | Moisture, Temperature, Light Sensitive |
| InChI | InChI=1S/C12H10O5/c1-16-8-2-3-9-7(4-11(13)14)5-12(15)17-10(9)6-8/h2-3,5-6H,4H2,1H3,(H,13,14) |
| InChIKey | ZEKAXIFHLIITGV-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(OC)=CC=C2C(CC(O)=O)=C1 |
| CAS DataBase Reference | 62935-72-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H302-H332-H335 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P261-P271-P304+P340-P312-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| WGK Germany | 3 |
| HS Code | 2932209090 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |