(-)-alpha-Cedrene
- Product Name(-)-alpha-Cedrene
- CAS469-61-4
- CBNumberCB4729323
- MFC15H24
- MW204.35
- EINECS207-418-4
- MDL NumberMFCD00063003
- MOL File469-61-4.mol
Chemical Properties
| alpha | -88 º(c=10%, EtOH) |
| Boiling point: | 261-262 °C(lit.) |
| Density | 0.932 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 104°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Soluble), DMSO (Slightly, Heated), Ethanol (Very Slightly), Methanol |
| form | Oil |
| color | Colourless to Light Yellow |
| Odor | at 100.00 %. woody cedar sweet fresh |
| Odor Type | woody |
| optical activity | [α]20/D 88±1°, c = 10% in ethanol |
| BRN | 3196861 |
| Henry's Law Constant | 2.8×10-4 mol/(m3Pa) at 25℃, Copolovici and Niinemets (2015) |
| Dielectric constant | 3.2(24℃) |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h7,11-13H,5-6,8-9H2,1-4H3/t11-,12+,13+,15+/m1/s1 |
| InChIKey | IRAQOCYXUMOFCW-OSFYFWSMSA-N |
| SMILES | C[C@@H]1CC[C@H]2C(C)(C)[C@H]3C[C@@]12CC=C3C |
| LogP | 6.308 (est) |
| CAS DataBase Reference | 469-61-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-3a,7-methanoazulene, 2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-, [3r-(3«alpha»,3a«beta»,7«beta»,8a«alpha»)]-(469-61-4) |
| EPA Substance Registry System | 1H-3a,7-Methanoazulene, 2,3,4,7,8,8a-hexahydro-3,6,8,8-tetramethyl-, (3R,3aS,7S,8aS)- (469-61-4) |
Safety
| Symbol(GHS) |
  GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H400 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,N |
| Risk Statements | 36/38-50/53-50 |
| Safety Statements | 26-60-61-24/25-23 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | PB7725000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications |
Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 |