2-Bromo-6-(trifluoromethyl)pyridine
- Product Name2-Bromo-6-(trifluoromethyl)pyridine
- CAS189278-27-1
- CBNumberCB4496245
- MFC6H3BrF3N
- MW225.99
- MDL NumberMFCD00153087
- MOL File189278-27-1.mol
Chemical Properties
| Melting point: | 48-52 °C |
| Boiling point: | 78-79°C 14mm |
| Density | 1.707±0.06 g/cm3(Predicted) |
| Flash point: | 78-79°C/14mm |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | -3.89±0.12(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H3BrF3N/c7-5-3-1-2-4(11-5)6(8,9)10/h1-3H |
| InChIKey | DOWNSQADAFSSAR-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(C(F)(F)F)=CC=C1 |
| CAS DataBase Reference | 189278-27-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H319-H335 | |||||||||
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | T,Xi,Xn | |||||||||
| Risk Statements | 25-36/37/38-20/21/22 | |||||||||
| Safety Statements | 26-37/39-45-36/37/39-22 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 2933399090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|