Cyclopropylbenzene
- Product NameCyclopropylbenzene
- CAS873-49-4
- CBNumberCB4494610
- MFC9H10
- MW118.18
- EINECS212-839-1
- MDL NumberMFCD00001275
- MOL File873-49-4.mol
Chemical Properties
| Melting point: | -31°C |
| Boiling point: | 174 °C |
| Density | 0.92 |
| refractive index | n 20/D 1.533 (lit.) |
| Flash point: | 44 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C9H10/c1-2-4-8(5-3-1)9-6-7-9/h1-5,9H,6-7H2 |
| InChIKey | VFSFCYAQBIPUSL-UHFFFAOYSA-N |
| SMILES | C1(C2CC2)=CC=CC=C1 |
| CAS DataBase Reference | 873-49-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, cyclopropyl-(873-49-4) |
| EPA Substance Registry System | Cyclopropylbenzene (873-49-4) |
Safety
| Symbol(GHS) |
 GHS02 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H225 | |||||||||
| Precautionary statements | P210-P403+P235 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Risk Statements | 10 | |||||||||
| Safety Statements | 16 | |||||||||
| RIDADR | UN 3295 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 3.2 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2902909000 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| NFPA 704: |
|