Perylenebisimide with extended pi system
- Product NamePerylenebisimide with extended pi system
- CAS55034-79-2
- CBNumberCB4345330
- MFC36H16N4O2
- MW536.54
- MDL NumberMFCD00151610
- MOL File55034-79-2.mol
Chemical Properties
| Melting point: | >300°C |
| form | solid |
| InChIKey | CNXXSKARMYGQBG-UHFFFAOYSA-N |
| SMILES | O=C1C2=C3C(C4=NC5=CC=CC=C5N41)=CC=C(C6=CC=C(C(N7C8=NC9=C7C=CC=C9)=O)C%10=C8C=CC%11=C6%10)C3=C%11C=C2 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340+P312-P305+P351+P338-P337+P313 |
| target organs | Respiratory system |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |