Tetrabutyl orthosilicate
- Product NameTetrabutyl orthosilicate
- CAS4766-57-8
- CBNumberCB4217992
- MFC16H36O4Si
- MW320.54
- EINECS225-305-8
- MDL NumberMFCD00009432
- MOL File4766-57-8.mol
Chemical Properties
| Melting point: | -80 °C |
| Boiling point: | 277 °C |
| Density | 0.90 |
| vapor density | >1 (vs air) |
| refractive index | 1.41 |
| Flash point: | 136 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.9 |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1709274 |
| InChI | 1S/C16H36O4Si/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4/h5-16H2,1-4H3 |
| InChIKey | UQMOLLPKNHFRAC-UHFFFAOYSA-N |
| SMILES | CCCCO[Si](OCCCC)(OCCCC)OCCCC |
| CAS DataBase Reference | 4766-57-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrabutyl silicate(4766-57-8) |
| EPA Substance Registry System | Silicic acid (H4SiO4), tetrabutyl ester (4766-57-8) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338-P264-P280a-P321-P332+P313-P337+P313 | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39-37/39 | |||||||||
| RIDADR | UN2924 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2920900090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|