2,4-Dichloropyridine-3-carboxaldehyde
- Product Name2,4-Dichloropyridine-3-carboxaldehyde
- CAS134031-24-6
- CBNumberCB4132686
- MFC6H3Cl2NO
- MW176
- MDL NumberMFCD07437909
- MOL File134031-24-6.mol
Chemical Properties
| Melting point: | 72-75℃ |
| Boiling point: | 261.8±35.0 °C(Predicted) |
| Density | 1.488±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | -1.17±0.10(Predicted) |
| color | White to Orange to Green |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H3Cl2NO/c7-5-1-2-9-6(8)4(5)3-10/h1-3H |
| InChIKey | GWBHJHIZHNTJLA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(Cl)=C1C=O |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| RIDADR | UN 2811 6.1 / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2933399090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|
