134031-24-6
| Name | 2,4-Dichloropyridine-3-carboxaldehyde |
| CAS | 134031-24-6 |
| Molecular Formula | C6H3Cl2NO |
| MDL Number | MFCD07437909 |
| Molecular Weight | 176 |
| MOL File | 134031-24-6.mol |
Chemical Properties
| Melting point | 72-75℃ |
| Boiling point | 261.8±35.0 °C(Predicted) |
| density | 1.488±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | -1.17±0.10(Predicted) |
| color | White to Orange to Green |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H3Cl2NO/c7-5-1-2-9-6(8)4(5)3-10/h1-3H |
| InChIKey | GWBHJHIZHNTJLA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(Cl)=C1C=O |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
