7-Bromo-1H-indole-2,3-dione
- Product Name7-Bromo-1H-indole-2,3-dione
- CAS20780-74-9
- CBNumberCB3765683
- MFC8H4BrNO2
- MW226.03
- EINECS625-256-6
- MDL NumberMFCD00774354
- MOL File20780-74-9.mol
Chemical Properties
| Melting point: | 191-198 °C |
| Density | 1.826±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Slightly soluble. |
| pka | 8.69±0.20(Predicted) |
| form | powder to crystal |
| color | Orange to Amber to Dark red |
| InChI | InChI=1S/C8H4BrNO2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11/h1-3H,(H,10,11,12) |
| InChIKey | OCVKSIWBTJCXPV-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2Br)C(=O)C1=O |
| CAS DataBase Reference | 20780-74-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-37/38-41 | |||||||||
| Safety Statements | 26-39 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HS Code | 2933990099 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|
