Sodium ethylxanthogenate
- Product NameSodium ethylxanthogenate
- CAS140-90-9
- CBNumberCB3737895
- MFC3H7NaOS2
- MW146.2
- EINECS205-440-9
- MDL NumberMFCD00068314
- MOL File140-90-9.mol
Chemical Properties
| Boiling point: | 462.37℃[at 101 325 Pa] |
| Density | 1.558 |
| vapor pressure | 0-47000Pa at 25℃ |
| solubility | Soluble in water |
| form | powder to crystal |
| pka | 1.6[at 20 ℃] |
| color | Light orange to Yellow to Green |
| Odor | carbon disulfide odor |
| Water Solubility | 3.925-505g/L at 20-25℃ |
| Major Application | food and beverages pharmaceutical |
| InChI | InChI=1S/C3H6OS2.Na.H/c1-2-4-3(5)6;;/h2H2,1H3,(H,5,6);; |
| InChIKey | CWQWDXAVPXOYLQ-UHFFFAOYSA-N |
| SMILES | O(CC)C(S)=S.[NaH] |
| LogP | -2.48--2.24 at 20-25℃ |
| CAS DataBase Reference | 140-90-9(CAS DataBase Reference) |
| EPA Substance Registry System | Carbonodithioic acid, O-ethyl ester, sodium salt (1:1) (140-90-9) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H252 |
| Precautionary statements | P501-P270-P235+P410-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P407-P420-P413 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3342 |
| TSCA | TSCA listed |
| HazardClass | 4.2 |
| PackingGroup | II |
| HS Code | 2930909899 |
| REACH Registrations | Active |