2',5'-Dichloroacetophenone
- Product Name2',5'-Dichloroacetophenone
- CAS2476-37-1
- CBNumberCB3482540
- MFC8H6Cl2O
- MW189.04
- EINECS219-605-8
- MDL NumberMFCD00000607
- MOL File2476-37-1.mol
Chemical Properties
| Melting point: | 14 °C |
| Boiling point: | 128 °C/12 mmHg |
| Density | 1.33 |
| refractive index | 1.56 |
| Flash point: | Not applicable |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.312 |
| BRN | 1865043 |
| InChI | InChI=1S/C8H6Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,1H3 |
| InChIKey | CYNFEPKQDJHIMV-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Cl)=CC=C1Cl)C |
| CAS DataBase Reference | 2476-37-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Dichloroacetophenone(2476-37-1) |
| EPA Substance Registry System | Ethanone, 1-(2,5-dichlorophenyl)- (2476-37-1) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319 | |||||||||
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 | |||||||||
| PPE | Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/38-36/37/38 | |||||||||
| Safety Statements | 24/25-36-26-37-23 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|