p-Nitrophenyl beta-D-lactopyranoside
- Product Namep-Nitrophenyl beta-D-lactopyranoside
- CAS4419-94-7
- CBNumberCB3442018
- MFC18H25NO13
- MW463.39
- EINECS1533716-785-6
- MDL NumberMFCD00069843
- MOL File4419-94-7.mol
Chemical Properties
| Melting point: | 263-265°C |
| Boiling point: | 795.6±60.0 °C(Predicted) |
| Density | 1.70±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Water (Slightly, Heated) |
| pka | 12.43±0.70(Predicted) |
| form | powder |
| color | white |
| Water Solubility | water: 19.60-20.40mg/mL, clear to slightly hazy, colorless to yellow |
| InChI | 1S/C18H25NO13/c20-5-9-11(22)12(23)14(25)18(30-9)32-16-10(6-21)31-17(15(26)13(16)24)29-8-3-1-7(2-4-8)19(27)28/h1-4,9-18,20-26H,5-6H2 |
| InChIKey | IAYJZWFYUSNIPN-MUKCROHVSA-N |
| SMILES | OCC1OC(OC2C(O)C(O)C(OC2CO)Oc3ccc(cc3)N(=O)=O)C(O)C(O)C1O |
Safety
| Symbol(GHS) |
 GHS08 |
| Signal word | Danger |
| Hazard statements | H360D |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 61 |
| Safety Statements | 53-45 |
| WGK Germany | 3 |
| HS Code | 2940009000 |
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |