5-Methoxy-2-methylaniline
- Product Name5-Methoxy-2-methylaniline
- CAS50868-72-9
- CBNumberCB3401640
- MFC8H11NO
- MW137.18
- EINECS256-816-4
- MDL NumberMFCD00075057
- MOL File50868-72-9.mol
Chemical Properties
| Melting point: | 43-46 °C (lit.) |
| Boiling point: | 253°C(lit.) |
| Density | 1.0630 (rough estimate) |
| refractive index | 1.5647 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Powder |
| pka | 4.03±0.10(Predicted) |
| color | Off-white to pale grey to yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H11NO/c1-6-3-4-7(10-2)5-8(6)9/h3-5H,9H2,1-2H3 |
| InChIKey | RPJXLEZOFUNGNZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(OC)=CC=C1C |
Safety
| Symbol(GHS) |
  GHS07,GHS06 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H331-H302-H312-H315-H319-H332-H335 | |||||||||
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405-P501a | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 2922299090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|
