Ocimene
- Product NameOcimene
- CAS13877-91-3
- CBNumberCB3394467
- MFC10H16
- MW136.23
- EINECS237-641-2
- MDL NumberMFCD00026437
- MOL File13877-91-3.mol
Chemical Properties
| Melting point: | -27.17°C (estimate) |
| Boiling point: | 65-66 °C/13 mmHg |
| Density | 0.818 g/mL at 20 °C (lit.) |
| vapor pressure | 2.207hPa at 24℃ |
| FEMA | 3539 | 3,7-DIMETHYL-1,3,6-OCTATRIENE |
| refractive index | n 20/D 1.485 |
| Flash point: | 56 °C - closed cup |
| storage temp. | 2-8°C |
| solubility | Chloroform: Slightly Soluble; Methanol: Slightly Soluble |
| form | liquid |
| Specific Gravity | 0.80 |
| color | Colorless to light yellow |
| Odor | at 100.00 %. citrus tropical green terpene woody green |
| Odor Type | floral |
| biological source | synthetic |
| Water Solubility | 14.5mg/L at 24℃ |
| JECFA Number | 1338 |
| BRN | 1736172 |
| Henry's Law Constant | 4.0×10-4 mol/(m3Pa) at 25℃, Copolovici and Niinemets (2005) |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | IHPKGUQCSIINRJ-UHFFFAOYSA-N |
| SMILES | [H]C(CC([H])=C(C)C=C)=C(C)C |
| LogP | 5.4 at 25℃ |
| EPA Substance Registry System | 1,3,6-Octatriene, 3,7-dimethyl- (13877-91-3) |
Safety
| Symbol(GHS) |
    GHS02,GHS07,GHS08,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H252-H304-H315-H410 | |||||||||
| Precautionary statements | P210-P235-P273-P301+P310-P303+P361+P353-P331 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Risk Statements | 10 | |||||||||
| Safety Statements | 16 | |||||||||
| RIDADR | UN2319 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials | |||||||||
| Hazard Classifications |
Aquatic Acute 1 Aquatic Chronic 2 Asp. Tox. 1 Flam. Liq. 3 Self-heat. 2 Skin Irrit. 2 |
|||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|