2-Fluoro-5-aminotoluene
- Product Name2-Fluoro-5-aminotoluene
- CAS452-69-7
- CBNumberCB3247303
- MFC7H8FN
- MW125.14
- EINECS207-207-7
- MDL NumberMFCD00025294
- MOL File452-69-7.mol
Chemical Properties
| Melting point: | 35 °C |
| Boiling point: | 85-86°C 9mm |
| Density | 1,12 g/cm3 |
| refractive index | 1.5370 |
| Flash point: | 95°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.78±0.10(Predicted) |
| color | White to Gray |
| BRN | 2935561 |
| InChI | InChI=1S/C7H8FN/c1-5-4-6(9)2-3-7(5)8/h2-4H,9H2,1H3 |
| InChIKey | NYMDPDNETOLVBS-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C(C)=C1 |
| CAS DataBase Reference | 452-69-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-3-methylaniline(452-69-7) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi,T | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36/37/39-36-27 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Toxic/Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2921430090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|