Tetraethylammonium hexafluorophosphate
- Product NameTetraethylammonium hexafluorophosphate
- CAS429-07-2
- CBNumberCB3133929
- MFC8H20F6NP
- MW275.22
- EINECS207-056-7
- MDL NumberMFCD00043179
- MOL File429-07-2.mol
Chemical Properties
| Melting point: | ≥300 °C (lit.) |
| storage temp. | Storage temp. 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystalline |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in water, alcohol, and acetonitrile. |
| Sensitive | Hygroscopic |
| BRN | 3748868 |
| InChI | InChI=1S/C8H20N.F6P/c1-5-9(6-2,7-3)8-4;1-7(2,3,4,5)6/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | KLKUOIXSIDDDCN-UHFFFAOYSA-N |
| SMILES | [P-](F)(F)(F)(F)(F)F.[N+](CC)(CC)(CC)CC |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN2811 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | BS6500000 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29239000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|