1,3-Indanedione
- Product Name1,3-Indanedione
- CAS606-23-5
- CBNumberCB2767206
- MFC9H6O2
- MW146.14
- EINECS210-109-7
- MDL NumberMFCD00003779
- MOL File606-23-5.mol
Chemical Properties
| Melting point: | 129-132 °C (lit.) |
| Boiling point: | 205.74°C (rough estimate) |
| Density | 1,37 g/cm3 |
| refractive index | 1.5049 (estimate) |
| storage temp. | Store below +30°C. |
| pka | 8.95±0.20(Predicted) |
| form | Powder |
| color | White to yellow to beige |
| Water Solubility | Soluble in ethanol, ether, benzene, slightly soluble in water. |
| BRN | 1210061 |
| InChI | InChI=1S/C9H6O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-4H,5H2 |
| InChIKey | UHKAJLSKXBADFT-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C1 |
| CAS DataBase Reference | 606-23-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-Indene-1,3(2H)-dione(606-23-5) |
| EPA Substance Registry System | 1,3-Indandione (606-23-5) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 33-36/37/38 | |||||||||
| Safety Statements | 24/25-36/37/39-27-26 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NK5070000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29143900 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|