Zirconium(IV) isopropoxide isopropanol
- Product NameZirconium(IV) isopropoxide isopropanol
- CAS14717-56-7
- CBNumberCB2499136
- MFC15H35O5Zr
- MW386.66
- EINECS629-318-3
- MDL NumberMFCD00075157
- MOL File14717-56-7.mol
Chemical Properties
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | Soluble in hot isopropanol, warm hexane and toluene. Tends to precipitate over time. |
| form | crystal |
| color | white |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C3H8O.4C3H7O.Zr/c5*1-3(2)4;/h3-4H,1-2H3;4*3H,1-2H3;/q;4*-1;+4 |
| InChIKey | NIJDLRJGRCHJDB-UHFFFAOYSA-N |
| SMILES | CC(C)O.CC(C)O[Zr](OC(C)C)(OC(C)C)OC(C)C |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| RIDADR | UN3180 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2905190098 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|