Methyl 2-fluoroacrylate
- Product NameMethyl 2-fluoroacrylate
- CAS2343-89-7
- CBNumberCB2416636
- MFC4H5FO2
- MW104.08
- EINECS607-233-2
- MDL NumberMFCD04039286
- MOL File2343-89-7.mol
Chemical Properties
| Boiling point: | 41°C |
| Density | 1,114 g/cm3 |
| vapor pressure | 70.6hPa at 25℃ |
| refractive index | 1.39 |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C4H5FO2/c1-3(5)4(6)7-2/h1H2,2H3 |
| InChIKey | ZTZJVAOTIOAZGZ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(F)=C |
| LogP | 0.931 at 25℃ and pH6.3 |
| Surface tension | 71.5mN/m at 1g/L and 20.4℃ |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H302-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P261-P303+P361+P353-P305+P351+P338-P405-P501a | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 16-26-36-24/25 | |||||||||
| RIDADR | 1993 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | Ⅱ | |||||||||
| HS Code | 29161290 | |||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|
