Quaternium-15
- Product NameQuaternium-15
- CAS51229-78-8
- CBNumberCB2370628
- MFC9H16Cl2N4
- MW251.16
- MDL NumberMFCD00151463
- MOL File51229-78-8.mol
Chemical Properties
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Yellow |
| Stability: | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | PRESERVATIVE ANTIMICROBIAL |
| InChI | InChI=1S/C9H16ClN4.ClH/c10-2-1-3-14-7-11-4-12(8-14)6-13(5-11)9-14;/h1-2H,3-9H2;1H/q+1;/p-1/b2-1-; |
| InChIKey | UKHVLWKBNNSRRR-ODZAUARKSA-M |
| SMILES | [N+]12(C/C=C\Cl)CN3CN(CN(C3)C1)C2.[Cl-] |
| CAS DataBase Reference | 51229-78-8 |
| EPA Substance Registry System | cis-1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride (51229-78-8) |
Safety
| Symbol(GHS) |
    GHS02,GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H228-H302-H315-H317-H361d-H411 |
| Precautionary statements | P210-P280-P301+P312+P330-P370+P378 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-22-51/53-43-38-63 |
| Safety Statements | 16-36-61-36/37-33-22-7 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| HS Code | 2933990099 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications |
Acute Tox. 4 Oral Aquatic Chronic 2 Flam. Sol. 2 Repr. 2 Skin Irrit. 2 Skin Sens. 1 |
| REACH Registrations | Inactive |