(R)-(+)-WARFARIN
- Product Name(R)-(+)-WARFARIN
- CAS5543-58-8
- CBNumberCB2351124
- MFC19H16O4
- MW308.33
- EINECS226-908-9
- MDL NumberMFCD00272376
- MOL File5543-58-8.mol
Chemical Properties
| Melting point: | ≥170 °C |
| Boiling point: | 515.2±50.0 °C(Predicted) |
| Density | 1.307±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: soluble |
| form | A crystalline solid |
| pka | 4.50±1.00(Predicted) |
| color | white to pale yellow |
| InChI | 1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3/t15-/m1/s1 |
| InChIKey | PJVWKTKQMONHTI-OAHLLOKOSA-N |
| SMILES | [H][C@@](CC(C)=O)(c1ccccc1)C2=C(O)c3ccccc3OC2=O |
Safety
| Symbol(GHS) |
   GHS06,GHS08,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300+H310+H330-H360D-H372-H411 | |||||||||
| Precautionary statements | P202-P264-P273-P280-P302+P352+P310-P304+P340+P310 | |||||||||
| target organs | Blood | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 61-48/25-52/53 | |||||||||
| Safety Statements | 53-45-61 | |||||||||
| RIDADR | UN 2811 6.1/PG 1 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2932209090 | |||||||||
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
|||||||||
| Hazard Classifications |
Acute Tox. 1 Dermal Acute Tox. 1 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 Repr. 1A STOT RE 1 |
|||||||||
| NFPA 704: |
|