Quinoline-4-carboxylic acid
- Product NameQuinoline-4-carboxylic acid
- CAS486-74-8
- CBNumberCB2319294
- MFC10H7NO2
- MW173.17
- EINECS207-640-1
- MDL NumberMFCD00006782
- MOL File486-74-8.mol
Chemical Properties
| Melting point: | 254-255 °C (lit.) |
| Boiling point: | 348.7±15.0 °C(Predicted) |
| Density | 1.339±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| form | powder to crystal |
| pka | 1.03±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 5224 |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H,12,13) |
| InChIKey | VQMSRUREDGBWKT-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C(O)=O)=CC=1 |
| CAS DataBase Reference | 486-74-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38-36/38 | |||||||||
| Safety Statements | 26-36-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | GD3850000 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2933490090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|