486-74-8
| Name | QUINOLINE-4-CARBOXYLIC ACID |
| CAS | 486-74-8 |
| EINECS(EC#) | 207-640-1 |
| Molecular Formula | C10H7NO2 |
| MDL Number | MFCD00006782 |
| Molecular Weight | 173.17 |
| MOL File | 486-74-8.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 254-255 °C (lit.) |
| Boiling point | 348.7±15.0 °C(Predicted) |
| density | 1.339±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in DMSO |
| form | powder to crystal |
| pka | 1.03±0.10(Predicted) |
| color | White to Light yellow |
| Detection Methods | HPLC |
| BRN | 5224 |
| InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H,12,13) |
| InChIKey | VQMSRUREDGBWKT-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C(O)=O)=CC=1 |
| CAS DataBase Reference | 486-74-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | GD3850000 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |