2,6-Difluorophenol
- Product Name2,6-Difluorophenol
- CAS28177-48-2
- CBNumberCB2319067
- MFC6H4F2O
- MW130.09
- EINECS248-884-9
- MDL NumberMFCD00002158
- MOL File28177-48-2.mol
Chemical Properties
| Melting point: | 38-41 °C (lit.) |
| Boiling point: | 59-61 °C/17 mmHg (lit.) |
| Density | 1,27 g/cm3 |
| Flash point: | 138 °F |
| storage temp. | 2-8°C |
| solubility | ethanol: soluble50mg/mL, clear, colorless to light yellow |
| form | Crystalline Low Melting Solid |
| pka | 7.45±0.10(Predicted) |
| color | Colorless |
| Water Solubility | Slightly soluble in water. Soluble in ethanol. |
| BRN | 2043613 |
| Henry's Law Constant | 7.0×10-1 mol/(m3Pa) at 25℃, Hilal et al. (2008) |
| InChI | InChI=1S/C6H4F2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H |
| InChIKey | CKKOVFGIBXCEIJ-UHFFFAOYSA-N |
| SMILES | C1(O)=C(F)C=CC=C1F |
| CAS DataBase Reference | 28177-48-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Difluorophenol(28177-48-2) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | F,Xi,Xn | |||||||||
| Risk Statements | 11-36/37/38-20/21/22 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | UN 1325 4.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2908199090 | |||||||||
| Storage Class | 4.1B - Flammable solid hazardous materials | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 1.0 Kg (2.2 lbs) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|
