4-Acetamido-2-methylacetophenone
- Product Name4-Acetamido-2-methylacetophenone
- CAS34956-31-5
- CBNumberCB2313818
- MFC11H13NO2
- MW191.23
- EINECS233-305-4
- MDL NumberMFCD02258876
- MOL File34956-31-5.mol
Chemical Properties
| Melting point: | 137-140 °C(lit.) |
| Boiling point: | 385℃ |
| Density | 1.122 |
| Flash point: | 167℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.60±0.70(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C11H13NO2/c1-7-6-10(12-9(3)14)4-5-11(7)8(2)13/h4-6H,1-3H3,(H,12,14) |
| InChIKey | PTARWPNYVATTDE-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(C)=O)c(C)c1 |
| CAS DataBase Reference | 34956-31-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-37 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HS Code | 2924299090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|