(S)-(-)-Methyl 2-chloropropionate
- Product Name(S)-(-)-Methyl 2-chloropropionate
- CAS73246-45-4
- CBNumberCB2310312
- MFC4H7ClO2
- MW122.55
- EINECS412-470-8
- MDL NumberMFCD00062941
- MOL File73246-45-4.mol
Chemical Properties
| Boiling point: | 80-82 °C110 mm Hg(lit.) |
| Density | 1.143 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 101 °F |
| storage temp. | -20°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| optical activity | [α]20/D 26°, neat |
| BRN | 1720589 |
| InChI | InChI=1S/C4H7ClO2/c1-3(5)4(6)7-2/h3H,1-2H3/t3-/m0/s1 |
| InChIKey | JLEJCNOTNLZCHQ-VKHMYHEASA-N |
| SMILES | C(OC)(=O)[C@@H](Cl)C |
| CAS DataBase Reference | 73246-45-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanoic acid, 2-chloro-, methyl ester, (s)-(73246-45-4) |
| EPA Substance Registry System | Propanoic acid, 2-chloro-, methyl ester, (2S)- (73246-45-4) |
Safety
| Symbol(GHS) |
   GHS08,GHS02,GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H319-H373-H302 | |||||||||
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P270-P280-P301+P312+P330-P303+P361+P353-P305+P351+P338+P337+P313-P403+P235-P501-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 10-36-48/22 | |||||||||
| Safety Statements | 23-26-36 | |||||||||
| RIDADR | UN 2933 3/PG 3 | |||||||||
| WGK Germany | 1 | |||||||||
| F | 19 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2915900090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 3 STOT RE 2 |
|||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
