2-Chloro-4-cyanobenzenesulfonyl chloride
- Product Name2-Chloro-4-cyanobenzenesulfonyl chloride
- CAS254749-11-6
- CBNumberCB2308522
- MFC7H3Cl2NO2S
- MW236.08
- MDL NumberMFCD00177089
- MOL File254749-11-6.mol
Chemical Properties
| Melting point: | 102-106 °C |
| Boiling point: | 348.9±32.0 °C(Predicted) |
| Density | 1.65±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| Appearance | Off-white to light yellow Solid |
| InChI | 1S/C7H3Cl2NO2S/c8-6-3-5(4-10)1-2-7(6)13(9,11)12/h1-3H |
| InChIKey | GNJOWOAPHOFJBW-UHFFFAOYSA-N |
| SMILES | Clc1cc(ccc1S(Cl)(=O)=O)C#N |
| CAS DataBase Reference | 254749-11-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H317 | |||||||||
| Precautionary statements | P260-P272-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34-43 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 1759 8/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2926909090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Skin Corr. 1B Skin Sens. 1 |
|||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|