1,4-Phenylenebis(thiourea)
- Product Name1,4-Phenylenebis(thiourea)
- CAS1519-70-6
- CBNumberCB2245478
- MFC8H10N4S2
- MW226.32
- MDL NumberMFCD00022169
- MOL File1519-70-6.mol
Chemical Properties
| Melting point: | 219-220°C (dec.) |
| Boiling point: | 405.1±55.0 °C(Predicted) |
| Density | 1.553±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| pka | 12.57±0.70(Predicted) |
| Appearance | Light yellow to yellow Solid |
| BRN | 2114854 |
| InChI | InChI=1S/C8H10N4S2/c9-7(13)11-5-1-2-6(4-3-5)12-8(10)14/h1-4H,(H3,9,11,13)(H3,10,12,14) |
| InChIKey | AMNPXXIGUOKIPP-UHFFFAOYSA-N |
| SMILES | C1(NC(N)=S)=CC=C(NC(N)=S)C=C1 |
| CAS DataBase Reference | 1519-70-6 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302 | |||||||||
| Precautionary statements | P280f-P308+P313-P330-P501a | |||||||||
| Risk Statements | 22 | |||||||||
| Safety Statements | 22-36/37 | |||||||||
| RIDADR | 2811 | |||||||||
| RTECS | YU1292010 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2930909099 | |||||||||
| Toxicity | rat,LD,oral,> 500mg/kg (500mg/kg),National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 45, 1953. | |||||||||
| NFPA 704: |
|