3-(Acryloyloxy)-2-hydroxypropyl methacrylate
- Product Name3-(Acryloyloxy)-2-hydroxypropyl methacrylate
- CAS1709-71-3
- CBNumberCB2224233
- MFC10H14O5
- MW214.22
- MDL NumberMFCD00274303
- MOL File1709-71-3.mol
Chemical Properties
| Boiling point: | 130-155 °C(Press: 0.18-0.5 Torr) |
| Density | 1.14 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| Water Solubility | Insoluble in water |
| form | clear liquid |
| pka | 12.51±0.20(Predicted) |
| color | Colorless to Almost colorless |
| InChI | 1S/C10H14O5/c1-4-9(12)14-5-8(11)6-15-10(13)7(2)3/h4,8,11H,1-2,5-6H2,3H3 |
| InChIKey | ZODNDDPVCIAZIQ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(O)COC(=O)C=C |
| CAS DataBase Reference | 1709-71-3 |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H315-H317-H318 | |||||||||
| Precautionary statements | P280-P305+P351+P338+P310-P333+P313 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 38-41-43 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN1760 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| HS Code | 29161400 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |
|||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|