4-Fluorobenzenesulfonamide
- Product Name4-Fluorobenzenesulfonamide
- CAS402-46-0
- CBNumberCB2199609
- MFC6H6FNO2S
- MW175.18
- EINECS206-946-2
- MDL NumberMFCD00025384
- MOL File402-46-0.mol
Chemical Properties
| Melting point: | 124-127 °C (lit.) |
| Boiling point: | 307.9±44.0 °C(Predicted) |
| Density | 1.428±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 10.00±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | It is soluble in water. |
| InChI | InChI=1S/C6H6FNO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H2,8,9,10) |
| InChIKey | LFLSATHZMYYIAQ-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C(F)C=C1 |
| CAS DataBase Reference | 402-46-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | T,Xi | |||||||||
| Risk Statements | 23/24/25-36/37/38 | |||||||||
| Safety Statements | 26-36-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | DB2630000 | |||||||||
| Hazard Note | Irritant/Toxic | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2935900090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|