402-46-0
| Name | 4-Fluorobenzenesulfonamide |
| CAS | 402-46-0 |
| EINECS(EC#) | 206-946-2 |
| Molecular Formula | C6H6FNO2S |
| MDL Number | MFCD00025384 |
| Molecular Weight | 175.18 |
| MOL File | 402-46-0.mol |
Chemical Properties
| Melting point | 124-127 °C (lit.) |
| Boiling point | 307.9±44.0 °C(Predicted) |
| density | 1.428±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 10.00±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | It is soluble in water. |
| InChI | InChI=1S/C6H6FNO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H2,8,9,10) |
| InChIKey | LFLSATHZMYYIAQ-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C(F)C=C1 |
| CAS DataBase Reference | 402-46-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DB2630000 |
| Hazard Note | Irritant/Toxic |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |