3-Bromo-5-hydroxybenzoic acid
- Product Name3-Bromo-5-hydroxybenzoic acid
- CAS140472-69-1
- CBNumberCB1972245
- MFC7H5BrO3
- MW217.02
- MDL NumberMFCD06797980
- MOL File140472-69-1.mol
Chemical Properties
| Melting point: | 237-241 °C |
| Boiling point: | 388.1±32.0 °C(Predicted) |
| Density | 1.861±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.69±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H5BrO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9H,(H,10,11) |
| InChIKey | WGIBEMRBLBGETQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(O)=CC(Br)=C1 |
| CAS DataBase Reference | 140472-69-1 |
Safety
| Symbol(GHS) |
  GHS06,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H400 | |||||||||
| Precautionary statements | P273-P301+P310+P330 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves | |||||||||
| Hazard Codes | Xn,N | |||||||||
| Risk Statements | 22-50 | |||||||||
| Safety Statements | 61 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2918290000 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral Aquatic Acute 1 |
|||||||||
| NFPA 704: |
|