
140472-69-1
| Name | 3-BROMO-5-HYDROXYBENZOIC ACID |
| CAS | 140472-69-1 |
| Molecular Formula | C7H5BrO3 |
| MDL Number | MFCD06797980 |
| Molecular Weight | 217.03 |
| MOL File | 140472-69-1.mol |
Chemical Properties
| Melting point | 237-241 °C |
| Boiling point | 388.1±32.0 °C(Predicted) |
| density | 1.861±0.06 g/cm3(Predicted) |
| storage temp. | Room temperature. |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.69±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H5BrO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9H,(H,10,11) |
| InChIKey | WGIBEMRBLBGETQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(O)=CC(Br)=C1 |
| CAS DataBase Reference | 140472-69-1 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H400 |
| Precautionary statements | P273-P301+P310+P330 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2918290090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 |

