sulfatroxazole
- Product Namesulfatroxazole
- CAS23256-23-7
- CBNumberCB1937884
- MFC11H13N3O3S
- MW267.3
- EINECS245-530-5
- MDL NumberMFCD00865024
- MOL File23256-23-7.mol
Chemical Properties
| Melting point: | 193-195.5 °C |
| Boiling point: | 484.9±55.0 °C(Predicted) |
| Density | 1.411±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.93±0.50(Predicted) |
| color | Pale Yellow to Pale Brown |
| Major Application | forensics and toxicology |
| InChI | InChI=1S/C11H13N3O3S/c1-7-8(2)17-13-11(7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | DAUFGBIKKGOPJA-UHFFFAOYSA-N |
| SMILES | C1(S(NC2C(C)=C(C)ON=2)(=O)=O)=CC=C(N)C=C1 |
Safety
| Symbol(GHS) |
  GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H361d |
| Precautionary statements | P202-P261-P272-P280-P302+P352-P308+P313 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Repr. 2 Skin Sens. 1 |