2-Chloro-5-fluoronitrobenzene
- Product Name2-Chloro-5-fluoronitrobenzene
- CAS345-17-5
- CBNumberCB1479986
- MFC6H3ClFNO2
- MW175.54
- EINECS206-456-9
- MDL NumberMFCD00084853
- MOL File345-17-5.mol
Chemical Properties
| Melting point: | 37-40 °C (lit.) |
| Boiling point: | 238 °C (lit.) |
| Density | 1.5019 (estimate) |
| Flash point: | 229 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump |
| color | Light yellow to Yellow to Orange |
| BRN | 2094191 |
| InChI | 1S/C6H3ClFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| InChIKey | DVXDJQKEEKXJBW-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(F)ccc1Cl |
| CAS DataBase Reference | 345-17-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | 2810 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2904990090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|