2-Chloro-3-nitrobenzoic acid
- Product Name2-Chloro-3-nitrobenzoic acid
- CAS3970-35-2
- CBNumberCB1464807
- MFC7H4ClNO4
- MW201.56
- EINECS223-590-3
- MDL NumberMFCD00007069
- MOL File3970-35-2.mol
Chemical Properties
| Melting point: | 183-187 °C (lit.) |
| Boiling point: | 359.9±27.0 °C(Predicted) |
| Density | 1.6620 |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | pK1: 2.02 (25°C) |
| color | White to cream-yellow with a green cast |
| BRN | 645427 |
| InChI | InChI=1S/C7H4ClNO4/c8-6-4(7(10)11)2-1-3-5(6)9(12)13/h1-3H,(H,10,11) |
| InChIKey | JRQDVRIQJJPHEQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC([N+]([O-])=O)=C1Cl |
| CAS DataBase Reference | 3970-35-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H317-H319 | |||||||||
| Precautionary statements | P261-P264-P272-P280-P302+P352-P305+P351+P338 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38-37/38-36 | |||||||||
| Safety Statements | 26-36-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2916399090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Sens. 1 |
|||||||||
| NFPA 704: |
|