1-Decyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
- Product Name1-Decyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
- CAS433337-23-6
- CBNumberCB12469796
- MFC16H27F6N3O4S2
- MW503.52
- EINECS200-145-6
- MDL NumberMFCD12022376
- MOL File433337-23-6.mol
Chemical Properties
| Melting point: | -19 °C |
| Boiling point: | 726.6 °C |
| Density | 1.29 |
| refractive index | 1.44 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C14H27N2.C2F6NO4S2/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h12-14H,3-11H2,1-2H3;/q+1;-1 |
| InChIKey | ZYVGZWFCGPUVSH-UHFFFAOYSA-N |
| SMILES | C(N1C=[N+](C)C=C1)CCCCCCCCC.S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P321-P332+P313-P337+P313-P362 |
| HS Code | 2933.29.9000 |