5-Hydroxyflavone
- Product Name5-Hydroxyflavone
- CAS491-78-1
- CBNumberCB1210129
- MFC15H10O3
- MW238.24
- EINECS207-743-1
- MDL NumberMFCD00016944
- MOL File491-78-1.mol
Chemical Properties
| Melting point: | 158-160°C |
| Boiling point: | 425.0±45.0 °C(Predicted) |
| Density | 1.340±0.06 g/cm3(Predicted) |
| pka | 6.76±0.40(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 194429 |
| InChI | 1S/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| InChIKey | IYBLVRRCNVHZQJ-UHFFFAOYSA-N |
| SMILES | Oc1cccc2OC(=CC(=O)c12)c3ccccc3 |
| LogP | 4.300 |
| CAS DataBase Reference | 491-78-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-36/37/39-27-37 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2932999099 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|