![2-[N,N-Bis(trifluoromethylsulfonyl)amino]pyridine Structure](https://www.chemicalbook.com/CAS/GIF/145100-50-1.gif)
2-[N,N-Bis(trifluoromethylsulfonyl)amino]pyridine
- Product Name2-[N,N-Bis(trifluoromethylsulfonyl)amino]pyridine
- CAS145100-50-1
- CBNumberCB1175244
- MFC7H4F6N2O4S2
- MW358.24
- MDL NumberMFCD00191834
- MOL File145100-50-1.mol
Chemical Properties
| Melting point: | 40-42 °C(lit.) |
| Boiling point: | 80-90 °C0.25 mm Hg(lit.) |
| Density | 1.7255 (estimate) |
| Flash point: | 230 °F |
| storage temp. | 2-8°C |
| pka | -5.98±0.10(Predicted) |
| form | Crystalline Powder or Crystals |
| color | White to almost white |
| Water Solubility | Hydrolyzes in water. |
| Sensitive | Moisture Sensitive |
| BRN | 5832565 |
| InChI | InChI=1S/C7H4F6N2O4S2/c8-6(9,10)20(16,17)15(5-3-1-2-4-14-5)21(18,19)7(11,12)13/h1-4H |
| InChIKey | DXLQEJHUQKKSRB-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(N(C1=NC=CC=C1)S(C(F)(F)F)(=O)=O)(=O)=O |
| CAS DataBase Reference | 145100-50-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN2811 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 9 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 29350090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|